C25H42ClNO3 — CID 70413207
1-[(2R,4S)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidin-1-yl]pentan-1-one;hydrochloride (PubChem CID 70413207) has the molecular formula C25H42ClNO3 and a molecular weight of 440.07 g/mol. Its IUPAC name is 1-[(2R,4S)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidin-1-yl]pentan-1-one;hydrochloride.
| Compound Name | 1-[(2R,4S)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidin-1-yl]pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 70413207 |
| Molecular Formula | C25H42ClNO3 |
| Molecular Weight | 440.07 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 1-[(2R,4S)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidin-1-yl]pentan-1-one;hydrochloride |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2C[C@@H](O)CCN2C(=O)CCCC)c(O)c1.Cl |
| InChI | InChI=1S/C25H41NO3.ClH/c1-5-7-9-10-15-25(3,4)19-12-13-21(23(28)17-19)22-18-20(27)14-16-26(22)24(29)11-8-6-2;/h12-13,17,20,22,27-28H,5-11,14-16,18H2,1-4H3;1H/t20-,22+;/m0./s1 |
| InChIKey | UHWVEIXHLVXJSO-IKGOIYPNSA-N |
| XLogP | 6.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|