C24H36O2 — CID 142270119
(4S,5S)-4-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one (PubChem CID 142270119) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is (4S,5S)-4-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one.
| Compound Name | (4S,5S)-4-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
|---|---|
| PubChem CID | 142270119 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (4S,5S)-4-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2CC(=O)C3C[C@@H]2C3(C)C)c(O)c1 |
| InChI | InChI=1S/C24H36O2/c1-6-7-8-9-12-23(2,3)16-10-11-17(21(25)13-16)18-14-22(26)20-15-19(18)24(20,4)5/h10-11,13,18-20,25H,6-9,12,14-15H2,1-5H3/t18-,19+,20?/m1/s1 |
| InChIKey | RVJKSRPXFZAQGC-LFPSWIHMSA-N |
| XLogP | 6.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|