C28H41NO7 — CID 118620235
[2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyloctan-2-yl)phenyl] 4-nitrooxybutanoate (PubChem CID 118620235) has the molecular formula C28H41NO7 and a molecular weight of 503.64 g/mol. Its IUPAC name is [2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyloctan-2-yl)phenyl] 4-nitrooxybutanoate.
| Compound Name | [2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyloctan-2-yl)phenyl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 118620235 |
| Molecular Formula | C28H41NO7 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | [2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyloctan-2-yl)phenyl] 4-nitrooxybutanoate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c([C@H]2CC(=O)[C@H]3C[C@@H]2C3(C)C)c(OC(=O)CCCO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H41NO7/c1-6-7-8-9-12-27(2,3)18-14-23(31)26(19-16-22(30)21-17-20(19)28(21,4)5)24(15-18)36-25(32)11-10-13-35-29(33)34/h14-15,19-21,31H,6-13,16-17H2,1-5H3/t19-,20-,21+/m0/s1 |
| InChIKey | WAHDPWOZDXLJQX-PCCBWWKXSA-N |
| XLogP | 6.25 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|