C20H27NO6 — CID 118620537
5-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]pentyl nitrate (PubChem CID 118620537) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is 5-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]pentyl nitrate.
| Compound Name | 5-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]pentyl nitrate |
|---|---|
| PubChem CID | 118620537 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 5-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]pentyl nitrate |
| SMILES | CC1(C)[C@@H]2C[C@H]1C(=O)C[C@H]2c1c(O)cc(O)cc1CCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C20H27NO6/c1-20(2)15-11-16(20)17(23)10-14(15)19-12(8-13(22)9-18(19)24)6-4-3-5-7-27-21(25)26/h8-9,14-16,22,24H,3-7,10-11H2,1-2H3/t14-,15-,16+/m1/s1 |
| InChIKey | RUOXQALSQQCABD-OAGGEKHMSA-N |
| XLogP | 3.74 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|