C24H29NO8 — CID 154068331
4-[3-hydroxy-5-(4-nitrooxybutyl)-4-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]phenoxy]-4-oxobut-2-enoic acid (PubChem CID 154068331) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[3-hydroxy-5-(4-nitrooxybutyl)-4-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]phenoxy]-4-oxobut-2-enoic acid.
| Compound Name | 4-[3-hydroxy-5-(4-nitrooxybutyl)-4-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]phenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 154068331 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 4-[3-hydroxy-5-(4-nitrooxybutyl)-4-[(1R,2S,5S)-4,6,6-trimethyl-2-bicyclo[3.1.1]hept-3-enyl]phenoxy]-4-oxobut-2-enoic acid |
| SMILES | CC1=C[C@H](c2c(O)cc(OC(=O)C=CC(=O)O)cc2CCCCO[N+](=O)[O-])[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H29NO8/c1-14-10-17(19-13-18(14)24(19,2)3)23-15(6-4-5-9-32-25(30)31)11-16(12-20(23)26)33-22(29)8-7-21(27)28/h7-8,10-12,17-19,26H,4-6,9,13H2,1-3H3,(H,27,28)/t17-,18-,19+/m0/s1 |
| InChIKey | VHJSBCSUWMTOQF-GBESFXJTSA-N |
| XLogP | 4.18 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|