C23H33NO5 — CID 118620278
7-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-3-yl]heptyl nitrate (PubChem CID 118620278) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 7-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-3-yl]heptyl nitrate.
| Compound Name | 7-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-3-yl]heptyl nitrate |
|---|---|
| PubChem CID | 118620278 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 7-[(6aR,10aR)-1-hydroxy-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-3-yl]heptyl nitrate |
| SMILES | CC1=C[C@H]2c3c(O)cc(CCCCCCCO[N+](=O)[O-])cc3OC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C23H33NO5/c1-16-10-11-19-18(13-16)22-20(25)14-17(15-21(22)29-23(19,2)3)9-7-5-4-6-8-12-28-24(26)27/h13-15,18-19,25H,4-12H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | GLAPVWFHGKUQMM-RTBURBONSA-N |
| XLogP | 5.70 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|