C28H37NO9 — CID 118620187
(Z)-4-[[(6aR,10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 118620187) has the molecular formula C28H37NO9 and a molecular weight of 531.60 g/mol. Its IUPAC name is (Z)-4-[[(6aR,10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[[(6aR,10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 118620187 |
| Molecular Formula | C28H37NO9 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | (Z)-4-[[(6aR,10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CC(C)(CCCCCCO[N+](=O)[O-])c1cc(OC(=O)/C=C\C(=O)O)c2c(c1)OC(C)(C)[C@@H]1CCC(=O)C[C@@H]21 |
| InChI | InChI=1S/C28H37NO9/c1-27(2,13-7-5-6-8-14-36-29(34)35)18-15-22(37-25(33)12-11-24(31)32)26-20-17-19(30)9-10-21(20)28(3,4)38-23(26)16-18/h11-12,15-16,20-21H,5-10,13-14,17H2,1-4H3,(H,31,32)/b12-11-/t20-,21-/m1/s1 |
| InChIKey | DHTWGZRVLDNMIA-HTQPURHSSA-N |
| XLogP | 5.29 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|