C26H38O5 — CID 123445646
[6,6-dimethyl-9-(2-methyloctan-2-yl)-2-oxo-4,5,5a,11b-tetrahydro-1H-oxepino[4,5-c]chromen-11-yl] acetate (PubChem CID 123445646) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is [6,6-dimethyl-9-(2-methyloctan-2-yl)-2-oxo-4,5,5a,11b-tetrahydro-1H-oxepino[4,5-c]chromen-11-yl] acetate.
| Compound Name | [6,6-dimethyl-9-(2-methyloctan-2-yl)-2-oxo-4,5,5a,11b-tetrahydro-1H-oxepino[4,5-c]chromen-11-yl] acetate |
|---|---|
| PubChem CID | 123445646 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [6,6-dimethyl-9-(2-methyloctan-2-yl)-2-oxo-4,5,5a,11b-tetrahydro-1H-oxepino[4,5-c]chromen-11-yl] acetate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(C)=O)c2c(c1)OC(C)(C)C1CCOC(=O)CC21 |
| InChI | InChI=1S/C26H38O5/c1-7-8-9-10-12-25(3,4)18-14-21(30-17(2)27)24-19-16-23(28)29-13-11-20(19)26(5,6)31-22(24)15-18/h14-15,19-20H,7-13,16H2,1-6H3 |
| InChIKey | YQNFIMANVIKUPZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|