C42H55NO8 — CID 166758534
[6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 5-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-2,2-dimethylpentanoate (PubChem CID 166758534) has the molecular formula C42H55NO8 and a molecular weight of 701.90 g/mol. Its IUPAC name is [6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 5-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-2,2-dimethylpentanoate.
| Compound Name | [6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 5-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 166758534 |
| Molecular Formula | C42H55NO8 |
| Molecular Weight | 701.90 g/mol |
| Exact Mass | 701.39 |
| IUPAC Name | [6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 5-[(7-methoxy-2-oxochromene-3-carbonyl)amino]-2,2-dimethylpentanoate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(=O)C(C)(C)CCCNC(=O)c2cc3ccc(OC)cc3oc2=O)c2c(c1)OC(C)(C)C1CCC(=O)CC21 |
| InChI | InChI=1S/C42H55NO8/c1-9-10-11-12-18-40(2,3)27-22-34(36-30-24-28(44)15-17-32(30)42(6,7)51-35(36)23-27)50-39(47)41(4,5)19-13-20-43-37(45)31-21-26-14-16-29(48-8)25-33(26)49-38(31)46/h14,16,21-23,25,30,32H,9-13,15,17-20,24H2,1-8H3,(H,43,45) |
| InChIKey | WGTBIZUGSPJCEZ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.90 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|