C32H49N3O3 — CID 156733801
[(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-pyrimidin-4-yl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate;azane;ethane (PubChem CID 156733801) has the molecular formula C32H49N3O3 and a molecular weight of 523.76 g/mol. Its IUPAC name is [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-pyrimidin-4-yl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate;azane;ethane.
| Compound Name | [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-pyrimidin-4-yl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate;azane;ethane |
|---|---|
| PubChem CID | 156733801 |
| Molecular Formula | C32H49N3O3 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.38 |
| IUPAC Name | [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-pyrimidin-4-yl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] acetate;azane;ethane |
| SMILES | CC.CCCCCCC(C)(C)c1cc(OC(C)=O)c2c(c1)OC(C)(C)[C@@H]1CC=C(c3ccncn3)C[C@@H]21.N |
| InChI | InChI=1S/C30H40N2O3.C2H6.H3N/c1-7-8-9-10-14-29(3,4)22-17-26(34-20(2)33)28-23-16-21(25-13-15-31-19-32-25)11-12-24(23)30(5,6)35-27(28)18-22;1-2;/h11,13,15,17-19,23-24H,7-10,12,14,16H2,1-6H3;1-2H3;1H3/t23-,24-;;/m1../s1 |
| InChIKey | MKRGUKZAAMCBMO-NILKIKDOSA-N |
| XLogP | 8.59 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|