C22H27NO3 — CID 153371306
(3-tert-butyl-9-cyano-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) acetate (PubChem CID 153371306) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3-tert-butyl-9-cyano-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) acetate.
| Compound Name | (3-tert-butyl-9-cyano-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) acetate |
|---|---|
| PubChem CID | 153371306 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3-tert-butyl-9-cyano-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl) acetate |
| SMILES | CC(=O)Oc1cc(C(C)(C)C)cc2c1C1CC(C#N)=CCC1C(C)(C)O2 |
| InChI | InChI=1S/C22H27NO3/c1-13(24)25-18-10-15(21(2,3)4)11-19-20(18)16-9-14(12-23)7-8-17(16)22(5,6)26-19/h7,10-11,16-17H,8-9H2,1-6H3 |
| InChIKey | NMLIBIAZYFTYIO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|