C35H54O5 — CID 153371158
[7-[1-(2,2-dimethylpropanoyloxy)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-7-methyloctyl] 2,2-dimethylpropanoate (PubChem CID 153371158) has the molecular formula C35H54O5 and a molecular weight of 554.81 g/mol. Its IUPAC name is [7-[1-(2,2-dimethylpropanoyloxy)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-7-methyloctyl] 2,2-dimethylpropanoate.
| Compound Name | [7-[1-(2,2-dimethylpropanoyloxy)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-7-methyloctyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 153371158 |
| Molecular Formula | C35H54O5 |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | [7-[1-(2,2-dimethylpropanoyloxy)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-7-methyloctyl] 2,2-dimethylpropanoate |
| SMILES | CC1=CCC2C(C1)c1c(OC(=O)C(C)(C)C)cc(C(C)(C)CCCCCCOC(=O)C(C)(C)C)cc1OC2(C)C |
| InChI | InChI=1S/C35H54O5/c1-23-16-17-26-25(20-23)29-27(39-31(37)33(5,6)7)21-24(22-28(29)40-35(26,10)11)34(8,9)18-14-12-13-15-19-38-30(36)32(2,3)4/h16,21-22,25-26H,12-15,17-20H2,1-11H3 |
| InChIKey | FORUZEWKHRHJMF-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|