C21H25BrF2O4 — CID 118620635
3-bromopropyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate (PubChem CID 118620635) has the molecular formula C21H25BrF2O4 and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-bromopropyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate.
| Compound Name | 3-bromopropyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate |
|---|---|
| PubChem CID | 118620635 |
| Molecular Formula | C21H25BrF2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 3-bromopropyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate |
| SMILES | CC1=CCC2C(C1)c1c(O)cc(C(F)(F)C(=O)OCCCBr)cc1OC2(C)C |
| InChI | InChI=1S/C21H25BrF2O4/c1-12-5-6-15-14(9-12)18-16(25)10-13(11-17(18)28-20(15,2)3)21(23,24)19(26)27-8-4-7-22/h5,10-11,14-15,25H,4,6-9H2,1-3H3 |
| InChIKey | BIUTVBZQLFOUJG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|