C30H40N2O5S — CID 73107363
6-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)-6-methyl-N-(4-sulfamoylphenyl)heptanamide (PubChem CID 73107363) has the molecular formula C30H40N2O5S and a molecular weight of 540.73 g/mol. Its IUPAC name is 6-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)-6-methyl-N-(4-sulfamoylphenyl)heptanamide.
| Compound Name | 6-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)-6-methyl-N-(4-sulfamoylphenyl)heptanamide |
|---|---|
| PubChem CID | 73107363 |
| Molecular Formula | C30H40N2O5S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 6-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)-6-methyl-N-(4-sulfamoylphenyl)heptanamide |
| SMILES | CC1=CCC2C(C1)c1c(O)cc(C(C)(C)CCCCC(=O)Nc3ccc(S(N)(=O)=O)cc3)cc1OC2(C)C |
| InChI | InChI=1S/C30H40N2O5S/c1-19-9-14-24-23(16-19)28-25(33)17-20(18-26(28)37-30(24,4)5)29(2,3)15-7-6-8-27(34)32-21-10-12-22(13-11-21)38(31,35)36/h9-13,17-18,23-24,33H,6-8,14-16H2,1-5H3,(H,32,34)(H2,31,35,36) |
| InChIKey | VYFMSGVLCVICHB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|