C28H42O4S — CID 158667384
(6aR,10aR)-9-(cyclopropylmethylsulfonyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 158667384) has the molecular formula C28H42O4S and a molecular weight of 474.71 g/mol. Its IUPAC name is (6aR,10aR)-9-(cyclopropylmethylsulfonyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-9-(cyclopropylmethylsulfonyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 158667384 |
| Molecular Formula | C28H42O4S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (6aR,10aR)-9-(cyclopropylmethylsulfonyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(S(=O)(=O)CC3CC3)C[C@@H]21 |
| InChI | InChI=1S/C28H42O4S/c1-6-7-8-9-14-27(2,3)20-15-24(29)26-22-17-21(33(30,31)18-19-10-11-19)12-13-23(22)28(4,5)32-25(26)16-20/h12,15-16,19,22-23,29H,6-11,13-14,17-18H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | IDNLJBDCKRWACB-DHIUTWEWSA-N |
| XLogP | 7.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|