C27H37F3O4 — CID 10576770
[(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 10576770) has the molecular formula C27H37F3O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is [(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10576770 |
| Molecular Formula | C27H37F3O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | [(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@H]1CC=C(COC(=O)C(F)(F)F)C[C@H]21 |
| InChI | InChI=1S/C27H37F3O4/c1-6-7-8-9-12-25(2,3)18-14-21(31)23-19-13-17(16-33-24(32)27(28,29)30)10-11-20(19)26(4,5)34-22(23)15-18/h10,14-15,19-20,31H,6-9,11-13,16H2,1-5H3/t19-,20-/m0/s1 |
| InChIKey | BSAPPNYFLGJZKT-PMACEKPBSA-N |
| XLogP | 7.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|