C28H42O6 — CID 153371168
2,3-dihydroxypropyl (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylate (PubChem CID 153371168) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylate.
| Compound Name | 2,3-dihydroxypropyl (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylate |
|---|---|
| PubChem CID | 153371168 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2,3-dihydroxypropyl (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(=O)OCC(O)CO)C[C@@H]21 |
| InChI | InChI=1S/C28H42O6/c1-6-7-8-9-12-27(2,3)19-14-23(31)25-21-13-18(26(32)33-17-20(30)16-29)10-11-22(21)28(4,5)34-24(25)15-19/h10,14-15,20-22,29-31H,6-9,11-13,16-17H2,1-5H3/t20?,21-,22-/m1/s1 |
| InChIKey | WLLHKUGGGBTIFU-HRUVVLKGSA-N |
| XLogP | 5.13 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|