C29H45NO4 — CID 153371254
(6aR,10aR)-1-hydroxy-N-(4-hydroxybutan-2-yl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide (PubChem CID 153371254) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is (6aR,10aR)-1-hydroxy-N-(4-hydroxybutan-2-yl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide.
| Compound Name | (6aR,10aR)-1-hydroxy-N-(4-hydroxybutan-2-yl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide |
|---|---|
| PubChem CID | 153371254 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | (6aR,10aR)-1-hydroxy-N-(4-hydroxybutan-2-yl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(=O)NC(C)CCO)C[C@@H]21 |
| InChI | InChI=1S/C29H45NO4/c1-7-8-9-10-14-28(3,4)21-17-24(32)26-22-16-20(27(33)30-19(2)13-15-31)11-12-23(22)29(5,6)34-25(26)18-21/h11,17-19,22-23,31-32H,7-10,12-16H2,1-6H3,(H,30,33)/t19?,22-,23-/m1/s1 |
| InChIKey | CHZQFOUPYREJNK-QENMJEOYSA-N |
| XLogP | 6.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|