C28H43NO5 — CID 158367498
(6aR,10aR)-N-(1,3-dihydroxypropan-2-yl)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide (PubChem CID 158367498) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is (6aR,10aR)-N-(1,3-dihydroxypropan-2-yl)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide.
| Compound Name | (6aR,10aR)-N-(1,3-dihydroxypropan-2-yl)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide |
|---|---|
| PubChem CID | 158367498 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | (6aR,10aR)-N-(1,3-dihydroxypropan-2-yl)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(=O)NC(CO)CO)C[C@@H]21 |
| InChI | InChI=1S/C28H43NO5/c1-6-7-8-9-12-27(2,3)19-14-23(32)25-21-13-18(26(33)29-20(16-30)17-31)10-11-22(21)28(4,5)34-24(25)15-19/h10,14-15,20-22,30-32H,6-9,11-13,16-17H2,1-5H3,(H,29,33)/t21-,22-/m1/s1 |
| InChIKey | MIIWNUWUZSWAMD-FGZHOGPDSA-N |
| XLogP | 4.70 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|