C29H42O6 — CID 100998772
4-[[(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methoxy]-4-oxobutanoic acid (PubChem CID 100998772) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is 4-[[(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 100998772 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 4-[[(6aS,10aS)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methoxy]-4-oxobutanoic acid |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@H]1CC=C(COC(=O)CCC(=O)O)C[C@H]21 |
| InChI | InChI=1S/C29H42O6/c1-6-7-8-9-14-28(2,3)20-16-23(30)27-21-15-19(18-34-26(33)13-12-25(31)32)10-11-22(21)29(4,5)35-24(27)17-20/h10,16-17,21-22,30H,6-9,11-15,18H2,1-5H3,(H,31,32)/t21-,22-/m0/s1 |
| InChIKey | SOKPEPFAPHUVLJ-VXKWHMMOSA-N |
| XLogP | 6.64 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|