C29H45NO2 — CID 69411821
6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(pyrrolidin-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 69411821) has the molecular formula C29H45NO2 and a molecular weight of 439.68 g/mol. Its IUPAC name is 6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(pyrrolidin-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(pyrrolidin-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 69411821 |
| Molecular Formula | C29H45NO2 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.35 |
| IUPAC Name | 6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(pyrrolidin-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(CN3CCCC3)CC21 |
| InChI | InChI=1S/C29H45NO2/c1-6-7-8-9-14-28(2,3)22-18-25(31)27-23-17-21(20-30-15-10-11-16-30)12-13-24(23)29(4,5)32-26(27)19-22/h12,18-19,23-24,31H,6-11,13-17,20H2,1-5H3 |
| InChIKey | AJORIJZJFOGHLD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|