C27H39N3O2 — CID 10181579
(6aS,10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(1,2,4-triazol-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 10181579) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is (6aS,10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(1,2,4-triazol-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aS,10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(1,2,4-triazol-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 10181579 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | (6aS,10aS)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(1,2,4-triazol-1-ylmethyl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@H]1CC=C(Cn3cncn3)C[C@H]21 |
| InChI | InChI=1S/C27H39N3O2/c1-6-7-8-9-12-26(2,3)20-14-23(31)25-21-13-19(16-30-18-28-17-29-30)10-11-22(21)27(4,5)32-24(25)15-20/h10,14-15,17-18,21-22,31H,6-9,11-13,16H2,1-5H3/t21-,22-/m0/s1 |
| InChIKey | JLJMFGVCQNUVIO-VXKWHMMOSA-N |
| XLogP | 6.52 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|