C25H37O3- — CID 145498047
(6aS,10aS)-9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-olate (PubChem CID 145498047) has the molecular formula C25H37O3- and a molecular weight of 385.57 g/mol. Its IUPAC name is (6aS,10aS)-9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-olate.
| Compound Name | (6aS,10aS)-9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-olate |
|---|---|
| PubChem CID | 145498047 |
| Molecular Formula | C25H37O3- |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | (6aS,10aS)-9-(hydroxymethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-olate |
| SMILES | CCCCCCC(C)(C)c1cc([O-])c2c(c1)OC(C)(C)[C@H]1CC=C(CO)C[C@H]21 |
| InChI | InChI=1S/C25H38O3/c1-6-7-8-9-12-24(2,3)18-14-21(27)23-19-13-17(16-26)10-11-20(19)25(4,5)28-22(23)15-18/h10,14-15,19-20,26-27H,6-9,11-13,16H2,1-5H3/p-1/t19-,20-/m0/s1 |
| InChIKey | SSQJFGMEZBFMNV-PMACEKPBSA-M |
| XLogP | 5.59 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|