C28H40N2O2S — CID 59086220
(6aS)-9-(1H-imidazol-2-ylsulfanylmethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 59086220) has the molecular formula C28H40N2O2S and a molecular weight of 468.71 g/mol. Its IUPAC name is (6aS)-9-(1H-imidazol-2-ylsulfanylmethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aS)-9-(1H-imidazol-2-ylsulfanylmethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 59086220 |
| Molecular Formula | C28H40N2O2S |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (6aS)-9-(1H-imidazol-2-ylsulfanylmethyl)-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@H]1CC=C(CSc3ncc[nH]3)CC21 |
| InChI | InChI=1S/C28H40N2O2S/c1-6-7-8-9-12-27(2,3)20-16-23(31)25-21-15-19(18-33-26-29-13-14-30-26)10-11-22(21)28(4,5)32-24(25)17-20/h10,13-14,16-17,21-22,31H,6-9,11-12,15,18H2,1-5H3,(H,29,30)/t21?,22-/m0/s1 |
| InChIKey | LYTMCILHVYGJLO-KEKNWZKVSA-N |
| XLogP | 7.75 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|