C32H48N2O4S — CID 22807634
N'-[(6aR,11aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10,11,11a-hexahydro-6aH-cyclohepta[c]chromen-9-yl]-4-methylbenzenesulfonohydrazide (PubChem CID 22807634) has the molecular formula C32H48N2O4S and a molecular weight of 556.81 g/mol. Its IUPAC name is N'-[(6aR,11aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10,11,11a-hexahydro-6aH-cyclohepta[c]chromen-9-yl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[(6aR,11aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10,11,11a-hexahydro-6aH-cyclohepta[c]chromen-9-yl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 22807634 |
| Molecular Formula | C32H48N2O4S |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | N'-[(6aR,11aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,9,10,11,11a-hexahydro-6aH-cyclohepta[c]chromen-9-yl]-4-methylbenzenesulfonohydrazide |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(NNS(=O)(=O)c3ccc(C)cc3)CC[C@@H]21 |
| InChI | InChI=1S/C32H48N2O4S/c1-7-8-9-10-19-31(3,4)23-20-28(35)30-26-17-13-24(14-18-27(26)32(5,6)38-29(30)21-23)33-34-39(36,37)25-15-11-22(2)12-16-25/h11-12,15-16,20-21,24,26-27,33-35H,7-10,13-14,17-19H2,1-6H3/t24?,26-,27-/m1/s1 |
| InChIKey | ACENCKUEUTXZET-HUHKAINZSA-N |
| XLogP | 7.25 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|