C27H41NO2 — CID 56618755
(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(prop-2-ynylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol (PubChem CID 56618755) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is (6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(prop-2-ynylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(prop-2-ynylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 56618755 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(prop-2-ynylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
| SMILES | C#CCNC1CC[C@@H]2[C@@H](C1)c1c(O)cc(C(C)(C)CCCCCC)cc1OC2(C)C |
| InChI | InChI=1S/C27H41NO2/c1-7-9-10-11-14-26(3,4)19-16-23(29)25-21-18-20(28-15-8-2)12-13-22(21)27(5,6)30-24(25)17-19/h2,16-17,20-22,28-29H,7,9-15,18H2,1,3-6H3/t20?,21-,22-/m1/s1 |
| InChIKey | ANHCNXNEMJZRKL-HRUVVLKGSA-N |
| XLogP | 6.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|