C30H47NO5 — CID 22807603
2-[[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]-acetylamino]ethyl acetate (PubChem CID 22807603) has the molecular formula C30H47NO5 and a molecular weight of 501.71 g/mol. Its IUPAC name is 2-[[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]-acetylamino]ethyl acetate.
| Compound Name | 2-[[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]-acetylamino]ethyl acetate |
|---|---|
| PubChem CID | 22807603 |
| Molecular Formula | C30H47NO5 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | 2-[[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]-acetylamino]ethyl acetate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(N(CCOC(C)=O)C(C)=O)C[C@@H]21 |
| InChI | InChI=1S/C30H47NO5/c1-8-9-10-11-14-29(4,5)22-17-26(34)28-24-19-23(31(20(2)32)15-16-35-21(3)33)12-13-25(24)30(6,7)36-27(28)18-22/h17-18,23-25,34H,8-16,19H2,1-7H3/t23?,24-,25-/m1/s1 |
| InChIKey | JGKZCKGUXCHMQB-OPWSDZRHSA-N |
| XLogP | 6.48 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|