C27H46ClNO2 — CID 70587478
(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(propan-2-ylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol;hydrochloride (PubChem CID 70587478) has the molecular formula C27H46ClNO2 and a molecular weight of 452.12 g/mol. Its IUPAC name is (6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(propan-2-ylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol;hydrochloride.
| Compound Name | (6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(propan-2-ylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol;hydrochloride |
|---|---|
| PubChem CID | 70587478 |
| Molecular Formula | C27H46ClNO2 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | (6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-(propan-2-ylamino)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol;hydrochloride |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(NC(C)C)C[C@@H]21.Cl |
| InChI | InChI=1S/C27H45NO2.ClH/c1-8-9-10-11-14-26(4,5)19-15-23(29)25-21-17-20(28-18(2)3)12-13-22(21)27(6,7)30-24(25)16-19;/h15-16,18,20-22,28-29H,8-14,17H2,1-7H3;1H/t20?,21-,22-;/m1./s1 |
| InChIKey | HWGPVLJOHHSRIA-XLRMYISISA-N |
| XLogP | 7.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|