C32H51NO6 — CID 54093429
[1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 54093429) has the molecular formula C32H51NO6 and a molecular weight of 545.76 g/mol. Its IUPAC name is [1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 54093429 |
| Molecular Formula | C32H51NO6 |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | [1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CCC(COC(=O)CNC(=O)OC(C)(C)C)CC21 |
| InChI | InChI=1S/C32H51NO6/c1-9-10-11-12-15-31(5,6)22-17-25(34)28-23-16-21(13-14-24(23)32(7,8)38-26(28)18-22)20-37-27(35)19-33-29(36)39-30(2,3)4/h17-18,21,23-24,34H,9-16,19-20H2,1-8H3,(H,33,36) |
| InChIKey | MVLMINPLKYURAN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|