C22H33NO5 — CID 118620339
[1-hydroxy-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl] nitrate (PubChem CID 118620339) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is [1-hydroxy-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl] nitrate.
| Compound Name | [1-hydroxy-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl] nitrate |
|---|---|
| PubChem CID | 118620339 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | [1-hydroxy-6,6-dimethyl-3-(2-methylhexan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl] nitrate |
| SMILES | CCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CCC(O[N+](=O)[O-])CC21 |
| InChI | InChI=1S/C22H33NO5/c1-6-7-10-21(2,3)14-11-18(24)20-16-13-15(28-23(25)26)8-9-17(16)22(4,5)27-19(20)12-14/h11-12,15-17,24H,6-10,13H2,1-5H3 |
| InChIKey | SUUHUWQQEKYPTK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|