C20H28O2 — CID 143174069
(10aR)-3-tert-butyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 143174069) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (10aR)-3-tert-butyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (10aR)-3-tert-butyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 143174069 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (10aR)-3-tert-butyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CC1=CCC2[C@@H](C1)c1c(O)cc(C(C)(C)C)cc1OC2(C)C |
| InChI | InChI=1S/C20H28O2/c1-12-7-8-15-14(9-12)18-16(21)10-13(19(2,3)4)11-17(18)22-20(15,5)6/h7,10-11,14-15,21H,8-9H2,1-6H3/t14-,15?/m1/s1 |
| InChIKey | XPHADQVQXKHSBO-GICMACPYSA-N |
| XLogP | 5.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|