C26H37NO3 — CID 166741004
(6aR,10aR)-3-tert-butyl-N-cyclohexyl-1-hydroxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide (PubChem CID 166741004) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (6aR,10aR)-3-tert-butyl-N-cyclohexyl-1-hydroxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide.
| Compound Name | (6aR,10aR)-3-tert-butyl-N-cyclohexyl-1-hydroxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide |
|---|---|
| PubChem CID | 166741004 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (6aR,10aR)-3-tert-butyl-N-cyclohexyl-1-hydroxy-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxamide |
| SMILES | CC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(=O)NC3CCCCC3)C[C@@H]21 |
| InChI | InChI=1S/C26H37NO3/c1-25(2,3)17-14-21(28)23-19-13-16(24(29)27-18-9-7-6-8-10-18)11-12-20(19)26(4,5)30-22(23)15-17/h11,14-15,18-20,28H,6-10,12-13H2,1-5H3,(H,27,29)/t19-,20-/m1/s1 |
| InChIKey | IQRYTJKAZNDCKV-WOJBJXKFSA-N |
| XLogP | 5.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |