C32H49NO5 — CID 161286075
[(3R)-1-[2-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl] formate (PubChem CID 161286075) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is [(3R)-1-[2-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl] formate.
| Compound Name | [(3R)-1-[2-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl] formate |
|---|---|
| PubChem CID | 161286075 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | [(3R)-1-[2-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl] formate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(O)CN3CCC[C@@H](OC=O)C3)C[C@@H]21 |
| InChI | InChI=1S/C32H49NO5/c1-6-7-8-9-14-31(2,3)23-17-27(35)30-25-16-22(12-13-26(25)32(4,5)38-29(30)18-23)28(36)20-33-15-10-11-24(19-33)37-21-34/h12,17-18,21,24-26,28,35-36H,6-11,13-16,19-20H2,1-5H3/t24-,25-,26-,28?/m1/s1 |
| InChIKey | RTXBXVSEJKESTK-RBMIZQDPSA-N |
| XLogP | 6.23 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|