C33H51NO5 — CID 158653830
[(3S)-1-[2-[(6aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl]methyl formate (PubChem CID 158653830) has the molecular formula C33H51NO5 and a molecular weight of 541.77 g/mol. Its IUPAC name is [(3S)-1-[2-[(6aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl]methyl formate.
| Compound Name | [(3S)-1-[2-[(6aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 158653830 |
| Molecular Formula | C33H51NO5 |
| Molecular Weight | 541.77 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | [(3S)-1-[2-[(6aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]-2-hydroxyethyl]piperidin-3-yl]methyl formate |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(O)CN3CCC[C@H](COC=O)C3)CC21 |
| InChI | InChI=1S/C33H51NO5/c1-6-7-8-9-14-32(2,3)25-17-28(36)31-26-16-24(12-13-27(26)33(4,5)39-30(31)18-25)29(37)20-34-15-10-11-23(19-34)21-38-22-35/h12,17-18,22-23,26-27,29,36-37H,6-11,13-16,19-21H2,1-5H3/t23-,26?,27+,29?/m0/s1 |
| InChIKey | IBWNZCRCXNGKMX-NFMPCHENSA-N |
| XLogP | 6.48 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|