C25H38O8 — CID 156557991
2-[(6aS,10aS)-1-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-2-(1-hydroxyhexyl)propane-1,1,3,3-tetrol (PubChem CID 156557991) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-[(6aS,10aS)-1-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-2-(1-hydroxyhexyl)propane-1,1,3,3-tetrol.
| Compound Name | 2-[(6aS,10aS)-1-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-2-(1-hydroxyhexyl)propane-1,1,3,3-tetrol |
|---|---|
| PubChem CID | 156557991 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[(6aS,10aS)-1-hydroxy-9-(hydroxymethyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]-2-(1-hydroxyhexyl)propane-1,1,3,3-tetrol |
| SMILES | CCCCCC(O)C(c1cc(O)c2c(c1)OC(C)(C)[C@H]1CC=C(CO)C[C@H]21)(C(O)O)C(O)O |
| InChI | InChI=1S/C25H38O8/c1-4-5-6-7-20(28)25(22(29)30,23(31)32)15-11-18(27)21-16-10-14(13-26)8-9-17(16)24(2,3)33-19(21)12-15/h8,11-12,16-17,20,22-23,26-32H,4-7,9-10,13H2,1-3H3/t16-,17-,20?/m0/s1 |
| InChIKey | QNVMIGJFXIETEX-NBJLRHFZSA-N |
| XLogP | 1.78 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|