C20H23BrF2O4 — CID 130265263
2-bromoethyl 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]phenyl]-2,2-difluoroacetate (PubChem CID 130265263) has the molecular formula C20H23BrF2O4 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2-bromoethyl 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]phenyl]-2,2-difluoroacetate.
| Compound Name | 2-bromoethyl 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 130265263 |
| Molecular Formula | C20H23BrF2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 2-bromoethyl 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-3-en-1-yl]phenyl]-2,2-difluoroacetate |
| SMILES | C=C(C)[C@@H]1CC=C(C)C[C@H]1c1c(O)cc(C(F)(F)C(=O)OCCBr)cc1O |
| InChI | InChI=1S/C20H23BrF2O4/c1-11(2)14-5-4-12(3)8-15(14)18-16(24)9-13(10-17(18)25)20(22,23)19(26)27-7-6-21/h4,9-10,14-15,24-25H,1,5-8H2,2-3H3/t14-,15+/m0/s1 |
| InChIKey | GUPWBDVSBBSRRW-LSDHHAIUSA-N |
| XLogP | 5.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|