C20H23F2NO8 — CID 118620473
3-nitrooxypropyl 2-[4-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2,2-difluoroacetate (PubChem CID 118620473) has the molecular formula C20H23F2NO8 and a molecular weight of 443.40 g/mol. Its IUPAC name is 3-nitrooxypropyl 2-[4-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2,2-difluoroacetate.
| Compound Name | 3-nitrooxypropyl 2-[4-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 118620473 |
| Molecular Formula | C20H23F2NO8 |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 3-nitrooxypropyl 2-[4-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2,2-difluoroacetate |
| SMILES | CC1(C)[C@@H]2C[C@H]1C(=O)C[C@H]2c1c(O)cc(C(F)(F)C(=O)OCCCO[N+](=O)[O-])cc1O |
| InChI | InChI=1S/C20H23F2NO8/c1-19(2)12-9-13(19)14(24)8-11(12)17-15(25)6-10(7-16(17)26)20(21,22)18(27)30-4-3-5-31-23(28)29/h6-7,11-13,25-26H,3-5,8-9H2,1-2H3/t11-,12-,13+/m1/s1 |
| InChIKey | XLNVQKCRQZBQGE-UPJWGTAASA-N |
| XLogP | 3.05 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|