C28H39F2IN2O9 — CID 118620420
[2-[5-[1,1-difluoro-2-(6-nitrooxyhexoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenoxy]-2-oxoethyl]-trimethylazanium iodide (PubChem CID 118620420) has the molecular formula C28H39F2IN2O9 and a molecular weight of 712.52 g/mol. Its IUPAC name is [2-[5-[1,1-difluoro-2-(6-nitrooxyhexoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenoxy]-2-oxoethyl]-trimethylazanium iodide.
| Compound Name | [2-[5-[1,1-difluoro-2-(6-nitrooxyhexoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenoxy]-2-oxoethyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 118620420 |
| Molecular Formula | C28H39F2IN2O9 |
| Molecular Weight | 712.52 g/mol |
| Exact Mass | 712.17 |
| IUPAC Name | [2-[5-[1,1-difluoro-2-(6-nitrooxyhexoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenoxy]-2-oxoethyl]-trimethylazanium iodide |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@@H](c1c(O)cc(C(F)(F)C(=O)OCCCCCCO[N+](=O)[O-])cc1OC(=O)C[N+](C)(C)C)CC2=O.[I-] |
| InChI | InChI=1S/C28H38F2N2O9.HI/c1-27(2)19-15-20(27)21(33)14-18(19)25-22(34)12-17(13-23(25)41-24(35)16-32(3,4)5)28(29,30)26(36)39-10-8-6-7-9-11-40-31(37)38;/h12-13,18-20H,6-11,14-16H2,1-5H3;1H/t18-,19-,20+;/m0./s1 |
| InChIKey | PMAHGHNDVIRFQL-WFBUOHSLSA-N |
| XLogP | 1.13 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.52 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|