C27H33NO11 — CID 118620513
(E)-4-[2-[(1R,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]phenoxy]-4-oxobut-2-enoic acid (PubChem CID 118620513) has the molecular formula C27H33NO11 and a molecular weight of 547.56 g/mol. Its IUPAC name is (E)-4-[2-[(1R,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]phenoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[(1R,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]phenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 118620513 |
| Molecular Formula | C27H33NO11 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | (E)-4-[2-[(1R,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]phenoxy]-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C(=O)OCCCCO[N+](=O)[O-])c1cc(O)c([C@H]2CC(=O)[C@H]3C[C@H]2C3(C)C)c(OC(=O)/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C27H33NO11/c1-26(2,25(34)37-9-5-6-10-38-28(35)36)15-11-20(30)24(21(12-15)39-23(33)8-7-22(31)32)16-13-19(29)18-14-17(16)27(18,3)4/h7-8,11-12,16-18,30H,5-6,9-10,13-14H2,1-4H3,(H,31,32)/b8-7+/t16-,17+,18+/m0/s1 |
| InChIKey | XAOXGQZTDSWSJC-AMGLGWGCSA-N |
| XLogP | 3.47 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|