C28H35NO10 — CID 90376554
(E)-4-[3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenoxy]-4-oxobut-2-enoic acid (PubChem CID 90376554) has the molecular formula C28H35NO10 and a molecular weight of 545.59 g/mol. Its IUPAC name is (E)-4-[3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90376554 |
| Molecular Formula | C28H35NO10 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | (E)-4-[3-hydroxy-5-[2-methyl-1-(4-nitrooxybutoxy)-1-oxopropan-2-yl]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)phenoxy]-4-oxobut-2-enoic acid |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(C(C)(C)C(=O)OCCCCO[N+](=O)[O-])cc1OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H35NO10/c1-17(2)20-9-8-18(3)14-21(20)26-22(30)15-19(16-23(26)39-25(33)11-10-24(31)32)28(4,5)27(34)37-12-6-7-13-38-29(35)36/h10-11,14-16,20-21,30H,1,6-9,12-13H2,2-5H3,(H,31,32)/b11-10+ |
| InChIKey | MFZHNAFYGLXUJK-ZHACJKMWSA-N |
| XLogP | 4.76 |
| TPSA | 162.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|