C23H31NO7 — CID 118620551
[(3S,4S)-3-[2,6-dihydroxy-4-(2-methyl-4-nitrooxybutan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate (PubChem CID 118620551) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is [(3S,4S)-3-[2,6-dihydroxy-4-(2-methyl-4-nitrooxybutan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S)-3-[2,6-dihydroxy-4-(2-methyl-4-nitrooxybutan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 118620551 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [(3S,4S)-3-[2,6-dihydroxy-4-(2-methyl-4-nitrooxybutan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
| SMILES | C=C(C)[C@H]1CCC(COC(C)=O)=C[C@@H]1c1c(O)cc(C(C)(C)CCO[N+](=O)[O-])cc1O |
| InChI | InChI=1S/C23H31NO7/c1-14(2)18-7-6-16(13-30-15(3)25)10-19(18)22-20(26)11-17(12-21(22)27)23(4,5)8-9-31-24(28)29/h10-12,18-19,26-27H,1,6-9,13H2,2-5H3/t18-,19+/m1/s1 |
| InChIKey | ZNGBSHJENAJCDP-MOPGFXCFSA-N |
| XLogP | 4.53 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|