C27H39BrO4 — CID 90128581
[(3R,4R)-3-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate (PubChem CID 90128581) has the molecular formula C27H39BrO4 and a molecular weight of 507.51 g/mol. Its IUPAC name is [(3R,4R)-3-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate.
| Compound Name | [(3R,4R)-3-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 90128581 |
| Molecular Formula | C27H39BrO4 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [(3R,4R)-3-[4-(8-bromo-2-methyloctan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
| SMILES | C=C(C)[C@@H]1CCC(COC(C)=O)=C[C@H]1c1c(O)cc(C(C)(C)CCCCCCBr)cc1O |
| InChI | InChI=1S/C27H39BrO4/c1-18(2)22-11-10-20(17-32-19(3)29)14-23(22)26-24(30)15-21(16-25(26)31)27(4,5)12-8-6-7-9-13-28/h14-16,22-23,30-31H,1,6-13,17H2,2-5H3/t22-,23+/m0/s1 |
| InChIKey | LXJMECZQDZUFTF-XZOQPEGZSA-N |
| XLogP | 7.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|