C23H32O4 — CID 118388857
[(3S,4S)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate (PubChem CID 118388857) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(3S,4S)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 118388857 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(3S,4S)-3-(2,6-dihydroxy-4-pentylphenyl)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
| SMILES | C=C(C)[C@H]1CCC(COC(C)=O)=C[C@@H]1c1c(O)cc(CCCCC)cc1O |
| InChI | InChI=1S/C23H32O4/c1-5-6-7-8-17-12-21(25)23(22(26)13-17)20-11-18(14-27-16(4)24)9-10-19(20)15(2)3/h11-13,19-20,25-26H,2,5-10,14H2,1,3-4H3/t19-,20+/m1/s1 |
| InChIKey | ILJBZYIZTNTWIK-UXHICEINSA-N |
| XLogP | 5.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|