C23H35O4P — CID 155575587
3-[methoxy(methyl)phosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol (PubChem CID 155575587) has the molecular formula C23H35O4P and a molecular weight of 406.50 g/mol. Its IUPAC name is 3-[methoxy(methyl)phosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol.
| Compound Name | 3-[methoxy(methyl)phosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol |
|---|---|
| PubChem CID | 155575587 |
| Molecular Formula | C23H35O4P |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-[methoxy(methyl)phosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenol |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OP(C)(=O)OC |
| InChI | InChI=1S/C23H35O4P/c1-7-8-9-10-18-14-21(24)23(22(15-18)27-28(6,25)26-5)20-13-17(4)11-12-19(20)16(2)3/h13-15,19-20,24H,2,7-12H2,1,3-6H3 |
| InChIKey | LSNPNRDMJNSCAU-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|