C25H34O5 — CID 165154282
4-[3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-4-oxobutanoic acid (PubChem CID 165154282) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is 4-[3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 165154282 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 4-[3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-4-oxobutanoic acid |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H34O5/c1-5-6-7-8-18-14-21(26)25(20-13-17(4)9-10-19(20)16(2)3)22(15-18)30-24(29)12-11-23(27)28/h13-15,19-20,26H,2,5-12H2,1,3-4H3,(H,27,28) |
| InChIKey | UHSMTMBPTXLAQO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|