C25H34O6 — CID 25177323
[3-(2-hydroxyacetyl)oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-hydroxyacetate (PubChem CID 25177323) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [3-(2-hydroxyacetyl)oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-hydroxyacetate.
| Compound Name | [3-(2-hydroxyacetyl)oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 25177323 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [3-(2-hydroxyacetyl)oxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-hydroxyacetate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OC(=O)CO)cc(CCCCC)cc1OC(=O)CO |
| InChI | InChI=1S/C25H34O6/c1-5-6-7-8-18-12-21(30-23(28)14-26)25(22(13-18)31-24(29)15-27)20-11-17(4)9-10-19(20)16(2)3/h11-13,19-20,26-27H,2,5-10,14-15H2,1,3-4H3/t19-,20+/m0/s1 |
| InChIKey | ARZDBOPKXCRHGV-VQTJNVASSA-N |
| XLogP | 4.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|