C31H50N2O4+2 — CID 76691111
trimethyl-[2-[2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-[2-(trimethylazaniumyl)acetyl]oxyphenoxy]-2-oxoethyl]azanium (PubChem CID 76691111) has the molecular formula C31H50N2O4+2 and a molecular weight of 514.75 g/mol. Its IUPAC name is trimethyl-[2-[2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-[2-(trimethylazaniumyl)acetyl]oxyphenoxy]-2-oxoethyl]azanium.
| Compound Name | trimethyl-[2-[2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-[2-(trimethylazaniumyl)acetyl]oxyphenoxy]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 76691111 |
| Molecular Formula | C31H50N2O4+2 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.38 |
| IUPAC Name | trimethyl-[2-[2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-[2-(trimethylazaniumyl)acetyl]oxyphenoxy]-2-oxoethyl]azanium |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC(=O)C[N+](C)(C)C)cc(CCCCC)cc1OC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C31H50N2O4/c1-11-12-13-14-24-18-27(36-29(34)20-32(5,6)7)31(26-17-23(4)15-16-25(26)22(2)3)28(19-24)37-30(35)21-33(8,9)10/h17-19,25-26H,2,11-16,20-21H2,1,3-10H3/q+2 |
| InChIKey | BMTCOQUMOOFKDP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|