C33H48N2O4 — CID 155748620
[3-[3-(1-methylaziridin-2-yl)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-methylaziridin-2-yl)propanoate (PubChem CID 155748620) has the molecular formula C33H48N2O4 and a molecular weight of 536.76 g/mol. Its IUPAC name is [3-[3-(1-methylaziridin-2-yl)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-methylaziridin-2-yl)propanoate.
| Compound Name | [3-[3-(1-methylaziridin-2-yl)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-methylaziridin-2-yl)propanoate |
|---|---|
| PubChem CID | 155748620 |
| Molecular Formula | C33H48N2O4 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | [3-[3-(1-methylaziridin-2-yl)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(1-methylaziridin-2-yl)propanoate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC(=O)CCC2CN2C)cc(CCCCC)cc1OC(=O)CCC1CN1C |
| InChI | InChI=1S/C33H48N2O4/c1-7-8-9-10-24-18-29(38-31(36)15-12-25-20-34(25)5)33(28-17-23(4)11-14-27(28)22(2)3)30(19-24)39-32(37)16-13-26-21-35(26)6/h17-19,25-28H,2,7-16,20-21H2,1,3-6H3 |
| InChIKey | XDQVQSDAZMLQSR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|