C29H43NO4 — CID 25028040
[3-methoxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 3-morpholin-4-ylpropanoate (PubChem CID 25028040) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is [3-methoxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 3-morpholin-4-ylpropanoate.
| Compound Name | [3-methoxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 25028040 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | [3-methoxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 3-morpholin-4-ylpropanoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=CC1c1c(OC)cc(CCCCC)cc1OC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C29H43NO4/c1-6-7-8-9-23-19-26(32-5)29(25-18-22(4)10-11-24(25)21(2)3)27(20-23)34-28(31)12-13-30-14-16-33-17-15-30/h18-20,24-25H,2,6-17H2,1,3-5H3/t24-,25?/m0/s1 |
| InChIKey | LGGNOXCMZLPRFN-SKCDSABHSA-N |
| XLogP | 6.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|