C28H36N2O4 — CID 177114651
[3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetyl-1H-imidazole-5-carboxylate (PubChem CID 177114651) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is [3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetyl-1H-imidazole-5-carboxylate.
| Compound Name | [3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetyl-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 177114651 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-acetyl-1H-imidazole-5-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OC)cc(CCCCC)cc1OC(=O)c1[nH]cnc1C(C)=O |
| InChI | InChI=1S/C28H36N2O4/c1-7-8-9-10-20-14-23(33-6)25(22-13-18(4)11-12-21(22)17(2)3)24(15-20)34-28(32)27-26(19(5)31)29-16-30-27/h13-16,21-22H,2,7-12H2,1,3-6H3,(H,29,30)/t21-,22+/m0/s1 |
| InChIKey | CXQPMCSCYBIKCF-FCHUYYIVSA-N |
| XLogP | 6.59 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|